C21H19BrFN3O3 — CID 121464009
2-bromo-1-[4-(4-fluoro-3-methylanilino)-7-(oxolan-3-yloxy)quinazolin-6-yl]ethanone (PubChem CID 121464009) has the molecular formula C21H19BrFN3O3 and a molecular weight of 460.30 g/mol. Its IUPAC name is 2-bromo-1-[4-(4-fluoro-3-methylanilino)-7-(oxolan-3-yloxy)quinazolin-6-yl]ethanone.
| Compound Name | 2-bromo-1-[4-(4-fluoro-3-methylanilino)-7-(oxolan-3-yloxy)quinazolin-6-yl]ethanone |
|---|---|
| PubChem CID | 121464009 |
| Molecular Formula | C21H19BrFN3O3 |
| Molecular Weight | 460.30 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | 2-bromo-1-[4-(4-fluoro-3-methylanilino)-7-(oxolan-3-yloxy)quinazolin-6-yl]ethanone |
| SMILES | Cc1cc(Nc2ncnc3cc(OC4CCOC4)c(C(=O)CBr)cc23)ccc1F |
| InChI | InChI=1S/C21H19BrFN3O3/c1-12-6-13(2-3-17(12)23)26-21-15-7-16(19(27)9-22)20(8-18(15)24-11-25-21)29-14-4-5-28-10-14/h2-3,6-8,11,14H,4-5,9-10H2,1H3,(H,24,25,26) |
| InChIKey | BDDQJIXXSOIFQR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.30 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|