C15H21FN2O3 — CID 178095684
2-amino-3-(5-fluoro-6-methoxy-4-methyl-1H-indol-3-yl)propanoic acid;ethane (PubChem CID 178095684) has the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. Its IUPAC name is 2-amino-3-(5-fluoro-6-methoxy-4-methyl-1H-indol-3-yl)propanoic acid;ethane.
| Compound Name | 2-amino-3-(5-fluoro-6-methoxy-4-methyl-1H-indol-3-yl)propanoic acid;ethane |
|---|---|
| PubChem CID | 178095684 |
| Molecular Formula | C15H21FN2O3 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2-amino-3-(5-fluoro-6-methoxy-4-methyl-1H-indol-3-yl)propanoic acid;ethane |
| SMILES | CC.COc1cc2[nH]cc(CC(N)C(=O)O)c2c(C)c1F |
| InChI | InChI=1S/C13H15FN2O3.C2H6/c1-6-11-7(3-8(15)13(17)18)5-16-9(11)4-10(19-2)12(6)14;1-2/h4-5,8,16H,3,15H2,1-2H3,(H,17,18);1-2H3 |
| InChIKey | FGGXPNWQYRPUNV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 88.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |