C8H9BrINO5S — CID 178122316
1-[(2-bromo-5-iodo-4-pyridinyl)oxy]propan-2-yl hydrogen sulfate (PubChem CID 178122316) has the molecular formula C8H9BrINO5S and a molecular weight of 438.04 g/mol. Its IUPAC name is 1-[(2-bromo-5-iodo-4-pyridinyl)oxy]propan-2-yl hydrogen sulfate.
| Compound Name | 1-[(2-bromo-5-iodo-4-pyridinyl)oxy]propan-2-yl hydrogen sulfate |
|---|---|
| PubChem CID | 178122316 |
| Molecular Formula | C8H9BrINO5S |
| Molecular Weight | 438.04 g/mol |
| Exact Mass | 436.84 |
| IUPAC Name | 1-[(2-bromo-5-iodo-4-pyridinyl)oxy]propan-2-yl hydrogen sulfate |
| SMILES | CC(COc1cc(Br)ncc1I)OS(=O)(=O)O |
| InChI | InChI=1S/C8H9BrINO5S/c1-5(16-17(12,13)14)4-15-7-2-8(9)11-3-6(7)10/h2-3,5H,4H2,1H3,(H,12,13,14) |
| InChIKey | DNIZNAOEJXPSGH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.04 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|