C29H33N3O5 — CID 178123065
2-[[3-methoxy-13-(2-pyrrolidin-1-ylethoxy)-[1,3]benzodioxolo[5,6-c]phenanthridin-2-yl]oxy]-N,N-dimethylethanamine (PubChem CID 178123065) has the molecular formula C29H33N3O5 and a molecular weight of 503.60 g/mol. Its IUPAC name is 2-[[3-methoxy-13-(2-pyrrolidin-1-ylethoxy)-[1,3]benzodioxolo[5,6-c]phenanthridin-2-yl]oxy]-N,N-dimethylethanamine.
| Compound Name | 2-[[3-methoxy-13-(2-pyrrolidin-1-ylethoxy)-[1,3]benzodioxolo[5,6-c]phenanthridin-2-yl]oxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 178123065 |
| Molecular Formula | C29H33N3O5 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 2-[[3-methoxy-13-(2-pyrrolidin-1-ylethoxy)-[1,3]benzodioxolo[5,6-c]phenanthridin-2-yl]oxy]-N,N-dimethylethanamine |
| SMILES | COc1cc2c(cc1OCCN(C)C)c(OCCN1CCCC1)nc1c3cc4c(cc3ccc21)OCO4 |
| InChI | InChI=1S/C29H33N3O5/c1-31(2)10-12-34-26-17-23-22(16-24(26)33-3)20-7-6-19-14-25-27(37-18-36-25)15-21(19)28(20)30-29(23)35-13-11-32-8-4-5-9-32/h6-7,14-17H,4-5,8-13,18H2,1-3H3 |
| InChIKey | ONXQOLFOZCTCEL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 65.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|