C37H49N6O5+ — CID 178123089
N-[3-[4-[2-(dimethylamino)ethylidene]piperazin-4-ium-1-yl]propyl]-2,3-dimethoxy-13-(2-pyrrolidin-1-ylethoxy)-[1,3]benzodioxolo[5,6-c]phenanthridin-5-amine (PubChem CID 178123089) has the molecular formula C37H49N6O5+ and a molecular weight of 657.84 g/mol. Its IUPAC name is N-[3-[4-[2-(dimethylamino)ethylidene]piperazin-4-ium-1-yl]propyl]-2,3-dimethoxy-13-(2-pyrrolidin-1-ylethoxy)-[1,3]benzodioxolo[5,6-c]phenanthridin-5-amine.
| Compound Name | N-[3-[4-[2-(dimethylamino)ethylidene]piperazin-4-ium-1-yl]propyl]-2,3-dimethoxy-13-(2-pyrrolidin-1-ylethoxy)-[1,3]benzodioxolo[5,6-c]phenanthridin-5-amine |
|---|---|
| PubChem CID | 178123089 |
| Molecular Formula | C37H49N6O5+ |
| Molecular Weight | 657.84 g/mol |
| Exact Mass | 657.38 |
| IUPAC Name | N-[3-[4-[2-(dimethylamino)ethylidene]piperazin-4-ium-1-yl]propyl]-2,3-dimethoxy-13-(2-pyrrolidin-1-ylethoxy)-[1,3]benzodioxolo[5,6-c]phenanthridin-5-amine |
| SMILES | COc1cc2c(OCCN3CCCC3)nc3c4cc5c(cc4cc(NCCCN4CC[N+](=CCN(C)C)CC4)c3c2cc1OC)OCO5 |
| InChI | InChI=1S/C37H49N6O5/c1-40(2)12-13-43-16-14-42(15-17-43)11-7-8-38-30-20-26-21-33-34(48-25-47-33)22-27(26)36-35(30)28-23-31(44-3)32(45-4)24-29(28)37(39-36)46-19-18-41-9-5-6-10-41/h13,20-24,38H,5-12,14-19,25H2,1-4H3/q+1 |
| InChIKey | UEBMUHDNAMITOL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.84 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|