C32H39N3O5 — CID 178123114
N,N-diethyl-2-[[2-methoxy-13-(3-pyrrolidin-1-ylpropoxy)-[1,3]benzodioxolo[5,6-c]phenanthridin-3-yl]oxy]ethanamine (PubChem CID 178123114) has the molecular formula C32H39N3O5 and a molecular weight of 545.68 g/mol. Its IUPAC name is N,N-diethyl-2-[[2-methoxy-13-(3-pyrrolidin-1-ylpropoxy)-[1,3]benzodioxolo[5,6-c]phenanthridin-3-yl]oxy]ethanamine.
| Compound Name | N,N-diethyl-2-[[2-methoxy-13-(3-pyrrolidin-1-ylpropoxy)-[1,3]benzodioxolo[5,6-c]phenanthridin-3-yl]oxy]ethanamine |
|---|---|
| PubChem CID | 178123114 |
| Molecular Formula | C32H39N3O5 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | N,N-diethyl-2-[[2-methoxy-13-(3-pyrrolidin-1-ylpropoxy)-[1,3]benzodioxolo[5,6-c]phenanthridin-3-yl]oxy]ethanamine |
| SMILES | CCN(CC)CCOc1cc2c(cc1OC)c(OCCCN1CCCC1)nc1c3cc4c(cc3ccc21)OCO4 |
| InChI | InChI=1S/C32H39N3O5/c1-4-34(5-2)14-16-37-29-19-25-23-10-9-22-17-28-30(40-21-39-28)18-24(22)31(23)33-32(26(25)20-27(29)36-3)38-15-8-13-35-11-6-7-12-35/h9-10,17-20H,4-8,11-16,21H2,1-3H3 |
| InChIKey | KKTVUKMERXMJLE-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 65.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|