C32H28N4O6 — CID 178123073
2,3,13-trimethoxy-5-[[1-[(4-methylphenyl)methyl]triazol-4-yl]methoxy]-[1,3]benzodioxolo[5,6-c]phenanthridine (PubChem CID 178123073) has the molecular formula C32H28N4O6 and a molecular weight of 564.60 g/mol. Its IUPAC name is 2,3,13-trimethoxy-5-[[1-[(4-methylphenyl)methyl]triazol-4-yl]methoxy]-[1,3]benzodioxolo[5,6-c]phenanthridine.
| Compound Name | 2,3,13-trimethoxy-5-[[1-[(4-methylphenyl)methyl]triazol-4-yl]methoxy]-[1,3]benzodioxolo[5,6-c]phenanthridine |
|---|---|
| PubChem CID | 178123073 |
| Molecular Formula | C32H28N4O6 |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | 2,3,13-trimethoxy-5-[[1-[(4-methylphenyl)methyl]triazol-4-yl]methoxy]-[1,3]benzodioxolo[5,6-c]phenanthridine |
| SMILES | COc1cc2c(OC)nc3c4cc5c(cc4cc(OCc4cn(Cc6ccc(C)cc6)nn4)c3c2cc1OC)OCO5 |
| InChI | InChI=1S/C32H28N4O6/c1-18-5-7-19(8-6-18)14-36-15-21(34-35-36)16-40-29-10-20-9-27-28(42-17-41-27)11-22(20)31-30(29)23-12-25(37-2)26(38-3)13-24(23)32(33-31)39-4/h5-13,15H,14,16-17H2,1-4H3 |
| InChIKey | MYWKWAGJDRHRTQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|