C10H12F3N3 — CID 178126361
(Z)-1-(N-amino-2,4,5-trifluoroanilino)but-1-en-2-amine (PubChem CID 178126361) has the molecular formula C10H12F3N3 and a molecular weight of 231.22 g/mol. Its IUPAC name is (Z)-1-(N-amino-2,4,5-trifluoroanilino)but-1-en-2-amine.
| Compound Name | (Z)-1-(N-amino-2,4,5-trifluoroanilino)but-1-en-2-amine |
|---|---|
| PubChem CID | 178126361 |
| Molecular Formula | C10H12F3N3 |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | (Z)-1-(N-amino-2,4,5-trifluoroanilino)but-1-en-2-amine |
| SMILES | CC/C(N)=C/N(N)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C10H12F3N3/c1-2-6(14)5-16(15)10-4-8(12)7(11)3-9(10)13/h3-5H,2,14-15H2,1H3/b6-5- |
| InChIKey | BQYKHSFLJVDRQW-WAYWQWQTSA-N |
| XLogP | 1.99 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|