C10H8F3NO — CID 140608170
(Z)-3-amino-4-(2,4,5-trifluorophenyl)but-2-enal (PubChem CID 140608170) has the molecular formula C10H8F3NO and a molecular weight of 215.17 g/mol. Its IUPAC name is (Z)-3-amino-4-(2,4,5-trifluorophenyl)but-2-enal.
| Compound Name | (Z)-3-amino-4-(2,4,5-trifluorophenyl)but-2-enal |
|---|---|
| PubChem CID | 140608170 |
| Molecular Formula | C10H8F3NO |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | (Z)-3-amino-4-(2,4,5-trifluorophenyl)but-2-enal |
| SMILES | N/C(=C\C=O)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C10H8F3NO/c11-8-5-10(13)9(12)4-6(8)3-7(14)1-2-15/h1-2,4-5H,3,14H2/b7-1- |
| InChIKey | ZZGCVCYXGHNKKZ-XFSBKJJWSA-N |
| XLogP | 1.69 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|