C15H9Br2NOS2 — CID 178132392
4,10-dibromo-7-(4-methoxyphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene (PubChem CID 178132392) has the molecular formula C15H9Br2NOS2 and a molecular weight of 443.19 g/mol. Its IUPAC name is 4,10-dibromo-7-(4-methoxyphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene.
| Compound Name | 4,10-dibromo-7-(4-methoxyphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
|---|---|
| PubChem CID | 178132392 |
| Molecular Formula | C15H9Br2NOS2 |
| Molecular Weight | 443.19 g/mol |
| Exact Mass | 440.85 |
| IUPAC Name | 4,10-dibromo-7-(4-methoxyphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
| SMILES | COc1ccc(-n2c3cc(Br)sc3c3sc(Br)cc32)cc1 |
| InChI | InChI=1S/C15H9Br2NOS2/c1-19-9-4-2-8(3-5-9)18-10-6-12(16)20-14(10)15-11(18)7-13(17)21-15/h2-7H,1H3 |
| InChIKey | MUWUUOXNACSNKD-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.19 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |