C32H37N5O5 — CID 178140242
3-[6-[(3S)-1-[(Z)-3-amino-2-[[3-(oxan-4-yl)phenyl]iminomethyl]prop-2-enyl]pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 178140242) has the molecular formula C32H37N5O5 and a molecular weight of 571.68 g/mol. Its IUPAC name is 3-[6-[(3S)-1-[(Z)-3-amino-2-[[3-(oxan-4-yl)phenyl]iminomethyl]prop-2-enyl]pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(3S)-1-[(Z)-3-amino-2-[[3-(oxan-4-yl)phenyl]iminomethyl]prop-2-enyl]pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 178140242 |
| Molecular Formula | C32H37N5O5 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | 3-[6-[(3S)-1-[(Z)-3-amino-2-[[3-(oxan-4-yl)phenyl]iminomethyl]prop-2-enyl]pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | N/C=C(\C=N\c1cccc(C2CCOCC2)c1)CN1CC[C@H](Oc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C32H37N5O5/c33-16-21(17-34-25-3-1-2-23(14-25)22-9-12-41-13-10-22)18-36-11-8-27(20-36)42-26-4-5-28-24(15-26)19-37(32(28)40)29-6-7-30(38)35-31(29)39/h1-5,14-17,22,27,29H,6-13,18-20,33H2,(H,35,38,39)/b21-16+,34-17+/t27-,29?/m0/s1 |
| InChIKey | SOPHCKWXVBTOLQ-YJZFSUBGSA-N |
| XLogP | 3.04 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|