C32H36FN5O5 — CID 178139948
3-[6-[(3S)-1-[(Z)-3-amino-2-[[3-fluoro-5-(oxan-4-yl)phenyl]iminomethyl]prop-2-enyl]pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 178139948) has the molecular formula C32H36FN5O5 and a molecular weight of 589.67 g/mol. Its IUPAC name is 3-[6-[(3S)-1-[(Z)-3-amino-2-[[3-fluoro-5-(oxan-4-yl)phenyl]iminomethyl]prop-2-enyl]pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(3S)-1-[(Z)-3-amino-2-[[3-fluoro-5-(oxan-4-yl)phenyl]iminomethyl]prop-2-enyl]pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 178139948 |
| Molecular Formula | C32H36FN5O5 |
| Molecular Weight | 589.67 g/mol |
| Exact Mass | 589.27 |
| IUPAC Name | 3-[6-[(3S)-1-[(Z)-3-amino-2-[[3-fluoro-5-(oxan-4-yl)phenyl]iminomethyl]prop-2-enyl]pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | N/C=C(\C=N\c1cc(F)cc(C2CCOCC2)c1)CN1CC[C@H](Oc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C32H36FN5O5/c33-24-11-22(21-6-9-42-10-7-21)12-25(14-24)35-16-20(15-34)17-37-8-5-27(19-37)43-26-1-2-28-23(13-26)18-38(32(28)41)29-3-4-30(39)36-31(29)40/h1-2,11-16,21,27,29H,3-10,17-19,34H2,(H,36,39,40)/b20-15+,35-16+/t27-,29?/m0/s1 |
| InChIKey | IVSIBRCCCYXBCU-HJYNYRCKSA-N |
| XLogP | 3.18 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.67 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|