C14H28N2S — CID 178147774
ethane;2-methyl-6-(thian-4-yl)-2,6-diazaspiro[3.4]octane (PubChem CID 178147774) has the molecular formula C14H28N2S and a molecular weight of 256.46 g/mol. Its IUPAC name is ethane;2-methyl-6-(thian-4-yl)-2,6-diazaspiro[3.4]octane.
| Compound Name | ethane;2-methyl-6-(thian-4-yl)-2,6-diazaspiro[3.4]octane |
|---|---|
| PubChem CID | 178147774 |
| Molecular Formula | C14H28N2S |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | ethane;2-methyl-6-(thian-4-yl)-2,6-diazaspiro[3.4]octane |
| SMILES | CC.CN1CC2(CCN(C3CCSCC3)C2)C1 |
| InChI | InChI=1S/C12H22N2S.C2H6/c1-13-8-12(9-13)4-5-14(10-12)11-2-6-15-7-3-11;1-2/h11H,2-10H2,1H3;1-2H3 |
| InChIKey | JIQXRTHRRPFKFZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |