About ethane;2-methyl-6-(thian-4-yl)-2,6-diazaspiro[3.4]octane
ethane;2-methyl-6-(thian-4-yl)-2,6-diazaspiro[3.4]octane (PubChem CID 178147774) has the molecular formula C14H28N2S
and a molecular weight of 256.46 g/mol. Its IUPAC name is ethane;2-methyl-6-(thian-4-yl)-2,6-diazaspiro[3.4]octane.
Molecular Properties
| Compound Name | ethane;2-methyl-6-(thian-4-yl)-2,6-diazaspiro[3.4]octane |
| PubChem CID | 178147774 |
| Molecular Formula | C14H28N2S |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | ethane;2-methyl-6-(thian-4-yl)-2,6-diazaspiro[3.4]octane |
| SMILES | CC.CN1CC2(CCN(C3CCSCC3)C2)C1 |
| InChI | InChI=1S/C12H22N2S.C2H6/c1-13-8-12(9-13)4-5-14(10-12)11-2-6-15-7-3-11;1-2/h11H,2-10H2,1H3;1-2H3 |
| InChIKey | JIQXRTHRRPFKFZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-methyl-6-(thian-4-yl)-2,6-diazaspiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-6-(thian-4-yl)-2,6-diazaspiro[3.4]octane?
The IUPAC name of ethane;2-methyl-6-(thian-4-yl)-2,6-diazaspiro[3.4]octane (CID 178147774) is ethane;2-methyl-6-(thian-4-yl)-2,6-diazaspiro[3.4]octane.
What is the SMILES notation for ethane;2-methyl-6-(thian-4-yl)-2,6-diazaspiro[3.4]octane?
The canonical SMILES for ethane;2-methyl-6-(thian-4-yl)-2,6-diazaspiro[3.4]octane is CC.CN1CC2(CCN(C3CCSCC3)C2)C1.
What is the InChIKey of ethane;2-methyl-6-(thian-4-yl)-2,6-diazaspiro[3.4]octane?
The InChIKey is JIQXRTHRRPFKFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2S.C2H6/c1-13-8-12(9-13)4-5-14(10-12)11-2-6-15-7-3-11;1-2/h11H,2-10H2,1H3;1-2H3.
What are the key properties of ethane;2-methyl-6-(thian-4-yl)-2,6-diazaspiro[3.4]octane?
ethane;2-methyl-6-(thian-4-yl)-2,6-diazaspiro[3.4]octane has a molecular weight of 256.46 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-6-(thian-4-yl)-2,6-diazaspiro[3.4]octane is sourced from PubChem (CID 178147774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).