C29H34FN5O3 — CID 178150511
4-[1-(3-fluoro-4-methylphenyl)-2-(4-prop-2-enoylpiperazin-1-yl)ethoxy]-N-[2-(1-methylpyrazol-3-yl)ethyl]benzamide (PubChem CID 178150511) has the molecular formula C29H34FN5O3 and a molecular weight of 519.62 g/mol. Its IUPAC name is 4-[1-(3-fluoro-4-methylphenyl)-2-(4-prop-2-enoylpiperazin-1-yl)ethoxy]-N-[2-(1-methylpyrazol-3-yl)ethyl]benzamide.
| Compound Name | 4-[1-(3-fluoro-4-methylphenyl)-2-(4-prop-2-enoylpiperazin-1-yl)ethoxy]-N-[2-(1-methylpyrazol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 178150511 |
| Molecular Formula | C29H34FN5O3 |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | 4-[1-(3-fluoro-4-methylphenyl)-2-(4-prop-2-enoylpiperazin-1-yl)ethoxy]-N-[2-(1-methylpyrazol-3-yl)ethyl]benzamide |
| SMILES | C=CC(=O)N1CCN(CC(Oc2ccc(C(=O)NCCc3ccn(C)n3)cc2)c2ccc(C)c(F)c2)CC1 |
| InChI | InChI=1S/C29H34FN5O3/c1-4-28(36)35-17-15-34(16-18-35)20-27(23-6-5-21(2)26(30)19-23)38-25-9-7-22(8-10-25)29(37)31-13-11-24-12-14-33(3)32-24/h4-10,12,14,19,27H,1,11,13,15-18,20H2,2-3H3,(H,31,37) |
| InChIKey | SEADULXXGNSEKL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|