C26H41N3 — CID 178160696
N-[1-[2-[(3E,5Z)-3,5-dimethylocta-1,3,5-trien-4-yl]iminopropyl]-4-ethenyl-2-methylpiperidin-3-yl]pent-1-en-3-imine (PubChem CID 178160696) has the molecular formula C26H41N3 and a molecular weight of 395.64 g/mol. Its IUPAC name is N-[1-[2-[(3E,5Z)-3,5-dimethylocta-1,3,5-trien-4-yl]iminopropyl]-4-ethenyl-2-methylpiperidin-3-yl]pent-1-en-3-imine.
| Compound Name | N-[1-[2-[(3E,5Z)-3,5-dimethylocta-1,3,5-trien-4-yl]iminopropyl]-4-ethenyl-2-methylpiperidin-3-yl]pent-1-en-3-imine |
|---|---|
| PubChem CID | 178160696 |
| Molecular Formula | C26H41N3 |
| Molecular Weight | 395.64 g/mol |
| Exact Mass | 395.33 |
| IUPAC Name | N-[1-[2-[(3E,5Z)-3,5-dimethylocta-1,3,5-trien-4-yl]iminopropyl]-4-ethenyl-2-methylpiperidin-3-yl]pent-1-en-3-imine |
| SMILES | C=C/C(CC)=N\C1C(C=C)CCN(C/C(C)=N/C(/C(C)=C\CC)=C(\C)C=C)C1C |
| InChI | InChI=1S/C26H41N3/c1-10-15-20(7)25(19(6)11-2)27-21(8)18-29-17-16-23(12-3)26(22(29)9)28-24(13-4)14-5/h11-13,15,22-23,26H,2-4,10,14,16-18H2,1,5-9H3/b20-15-,25-19+,27-21+,28-24+ |
| InChIKey | ZDPSCRIJXJWTSH-HXHDYYRJSA-N |
| XLogP | 6.57 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.64 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|