C9H14N2 — CID 178162935
3-ethyl-N-methyl-4H-azepin-2-amine (PubChem CID 178162935) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 3-ethyl-N-methyl-4H-azepin-2-amine.
| Compound Name | 3-ethyl-N-methyl-4H-azepin-2-amine |
|---|---|
| PubChem CID | 178162935 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 3-ethyl-N-methyl-4H-azepin-2-amine |
| SMILES | CCC1=C(NC)N=CC=CC1 |
| InChI | InChI=1S/C9H14N2/c1-3-8-6-4-5-7-11-9(8)10-2/h4-5,7,10H,3,6H2,1-2H3 |
| InChIKey | OIVFLAHAXXQYDY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |