About 1-bromo-4-methylbenzene;butan-1-amine;ethane
1-bromo-4-methylbenzene;butan-1-amine;ethane (PubChem CID 178163342) has the molecular formula C13H24BrN
and a molecular weight of 274.25 g/mol. Its IUPAC name is 1-bromo-4-methylbenzene;butan-1-amine;ethane.
Molecular Properties
| Compound Name | 1-bromo-4-methylbenzene;butan-1-amine;ethane |
| PubChem CID | 178163342 |
| Molecular Formula | C13H24BrN |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 1-bromo-4-methylbenzene;butan-1-amine;ethane |
| SMILES | CC.CCCCN.Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C7H7Br.C4H11N.C2H6/c1-6-2-4-7(8)5-3-6;1-2-3-4-5;1-2/h2-5H,1H3;2-5H2,1H3;1-2H3 |
| InChIKey | BXUPZKQEKZPSQK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-4-methylbenzene;butan-1-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-methylbenzene;butan-1-amine;ethane?
The IUPAC name of 1-bromo-4-methylbenzene;butan-1-amine;ethane (CID 178163342) is 1-bromo-4-methylbenzene;butan-1-amine;ethane.
What is the SMILES notation for 1-bromo-4-methylbenzene;butan-1-amine;ethane?
The canonical SMILES for 1-bromo-4-methylbenzene;butan-1-amine;ethane is CC.CCCCN.Cc1ccc(Br)cc1.
What is the InChIKey of 1-bromo-4-methylbenzene;butan-1-amine;ethane?
The InChIKey is BXUPZKQEKZPSQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Br.C4H11N.C2H6/c1-6-2-4-7(8)5-3-6;1-2-3-4-5;1-2/h2-5H,1H3;2-5H2,1H3;1-2H3.
What are the key properties of 1-bromo-4-methylbenzene;butan-1-amine;ethane?
1-bromo-4-methylbenzene;butan-1-amine;ethane has a molecular weight of 274.25 g/mol, XLogP of 4.53, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-methylbenzene;butan-1-amine;ethane is sourced from PubChem (CID 178163342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).