About [2-formyloxy-3-[hydroxy-[2-(methylamino)ethoxy]phosphanyl]oxypropyl] formate;methanol;propane
[2-formyloxy-3-[hydroxy-[2-(methylamino)ethoxy]phosphanyl]oxypropyl] formate;methanol;propane (PubChem CID 178164252) has the molecular formula C12H28NO8P
and a molecular weight of 345.33 g/mol. Its IUPAC name is [2-formyloxy-3-[hydroxy-[2-(methylamino)ethoxy]phosphanyl]oxypropyl] formate;methanol;propane.
Molecular Properties
| Compound Name | [2-formyloxy-3-[hydroxy-[2-(methylamino)ethoxy]phosphanyl]oxypropyl] formate;methanol;propane |
| PubChem CID | 178164252 |
| Molecular Formula | C12H28NO8P |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | [2-formyloxy-3-[hydroxy-[2-(methylamino)ethoxy]phosphanyl]oxypropyl] formate;methanol;propane |
| SMILES | CCC.CNCCOP(O)OCC(COC=O)OC=O.CO |
| InChI | InChI=1S/C8H16NO7P.C3H8.CH4O/c1-9-2-3-15-17(12)16-5-8(14-7-11)4-13-6-10;1-3-2;1-2/h6-9,12H,2-5H2,1H3;3H2,1-2H3;2H,1H3 |
| InChIKey | KVZIUCDHSMSJJS-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-formyloxy-3-[hydroxy-[2-(methylamino)ethoxy]phosphanyl]oxypropyl] formate;methanol;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-formyloxy-3-[hydroxy-[2-(methylamino)ethoxy]phosphanyl]oxypropyl] formate;methanol;propane?
The IUPAC name of [2-formyloxy-3-[hydroxy-[2-(methylamino)ethoxy]phosphanyl]oxypropyl] formate;methanol;propane (CID 178164252) is [2-formyloxy-3-[hydroxy-[2-(methylamino)ethoxy]phosphanyl]oxypropyl] formate;methanol;propane.
What is the SMILES notation for [2-formyloxy-3-[hydroxy-[2-(methylamino)ethoxy]phosphanyl]oxypropyl] formate;methanol;propane?
The canonical SMILES for [2-formyloxy-3-[hydroxy-[2-(methylamino)ethoxy]phosphanyl]oxypropyl] formate;methanol;propane is CCC.CNCCOP(O)OCC(COC=O)OC=O.CO.
What is the InChIKey of [2-formyloxy-3-[hydroxy-[2-(methylamino)ethoxy]phosphanyl]oxypropyl] formate;methanol;propane?
The InChIKey is KVZIUCDHSMSJJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16NO7P.C3H8.CH4O/c1-9-2-3-15-17(12)16-5-8(14-7-11)4-13-6-10;1-3-2;1-2/h6-9,12H,2-5H2,1H3;3H2,1-2H3;2H,1H3.
What are the key properties of [2-formyloxy-3-[hydroxy-[2-(methylamino)ethoxy]phosphanyl]oxypropyl] formate;methanol;propane?
[2-formyloxy-3-[hydroxy-[2-(methylamino)ethoxy]phosphanyl]oxypropyl] formate;methanol;propane has a molecular weight of 345.33 g/mol, XLogP of 0.20, 12 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [2-formyloxy-3-[hydroxy-[2-(methylamino)ethoxy]phosphanyl]oxypropyl] formate;methanol;propane is sourced from PubChem (CID 178164252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).