C12H28NO8P — CID 178164252
[2-formyloxy-3-[hydroxy-[2-(methylamino)ethoxy]phosphanyl]oxypropyl] formate;methanol;propane (PubChem CID 178164252) has the molecular formula C12H28NO8P and a molecular weight of 345.33 g/mol. Its IUPAC name is [2-formyloxy-3-[hydroxy-[2-(methylamino)ethoxy]phosphanyl]oxypropyl] formate;methanol;propane.
| Compound Name | [2-formyloxy-3-[hydroxy-[2-(methylamino)ethoxy]phosphanyl]oxypropyl] formate;methanol;propane |
|---|---|
| PubChem CID | 178164252 |
| Molecular Formula | C12H28NO8P |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | [2-formyloxy-3-[hydroxy-[2-(methylamino)ethoxy]phosphanyl]oxypropyl] formate;methanol;propane |
| SMILES | CCC.CNCCOP(O)OCC(COC=O)OC=O.CO |
| InChI | InChI=1S/C8H16NO7P.C3H8.CH4O/c1-9-2-3-15-17(12)16-5-8(14-7-11)4-13-6-10;1-3-2;1-2/h6-9,12H,2-5H2,1H3;3H2,1-2H3;2H,1H3 |
| InChIKey | KVZIUCDHSMSJJS-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|