C10H20NO9P — CID 177064211
formaldehyde;[3-[hydroxy-[2-(methoxycarbonylamino)ethoxy]phosphanyl]oxy-2-methoxypropyl] formate (PubChem CID 177064211) has the molecular formula C10H20NO9P and a molecular weight of 329.24 g/mol. Its IUPAC name is formaldehyde;[3-[hydroxy-[2-(methoxycarbonylamino)ethoxy]phosphanyl]oxy-2-methoxypropyl] formate.
| Compound Name | formaldehyde;[3-[hydroxy-[2-(methoxycarbonylamino)ethoxy]phosphanyl]oxy-2-methoxypropyl] formate |
|---|---|
| PubChem CID | 177064211 |
| Molecular Formula | C10H20NO9P |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | formaldehyde;[3-[hydroxy-[2-(methoxycarbonylamino)ethoxy]phosphanyl]oxy-2-methoxypropyl] formate |
| SMILES | C=O.COC(=O)NCCOP(O)OCC(COC=O)OC |
| InChI | InChI=1S/C9H18NO8P.CH2O/c1-14-8(5-16-7-11)6-18-19(13)17-4-3-10-9(12)15-2;1-2/h7-8,13H,3-6H2,1-2H3,(H,10,12);1H2 |
| InChIKey | IMDUVHQGAHRKME-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|