C29H36N3O4- — CID 178166857
3-methyl-4-[4-[[(2R)-1-[(4-propan-2-ylphenyl)carbamoyl]pyrrolidine-2-carbonyl]amino]cyclohexyl]benzoate (PubChem CID 178166857) has the molecular formula C29H36N3O4- and a molecular weight of 490.62 g/mol. Its IUPAC name is 3-methyl-4-[4-[[(2R)-1-[(4-propan-2-ylphenyl)carbamoyl]pyrrolidine-2-carbonyl]amino]cyclohexyl]benzoate.
| Compound Name | 3-methyl-4-[4-[[(2R)-1-[(4-propan-2-ylphenyl)carbamoyl]pyrrolidine-2-carbonyl]amino]cyclohexyl]benzoate |
|---|---|
| PubChem CID | 178166857 |
| Molecular Formula | C29H36N3O4- |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 3-methyl-4-[4-[[(2R)-1-[(4-propan-2-ylphenyl)carbamoyl]pyrrolidine-2-carbonyl]amino]cyclohexyl]benzoate |
| SMILES | Cc1cc(C(=O)[O-])ccc1C1CCC(NC(=O)[C@H]2CCCN2C(=O)Nc2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C29H37N3O4/c1-18(2)20-6-11-24(12-7-20)31-29(36)32-16-4-5-26(32)27(33)30-23-13-8-21(9-14-23)25-15-10-22(28(34)35)17-19(25)3/h6-7,10-12,15,17-18,21,23,26H,4-5,8-9,13-14,16H2,1-3H3,(H,30,33)(H,31,36)(H,34,35)/p-1/t21?,23?,26-/m1/s1 |
| InChIKey | KKHTXCXCYNSNRT-GMLYINLCSA-M |
| XLogP | 4.32 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |