C15H26N2O5 — CID 178168035
tert-butyl N-(1-formylcyclopropyl)carbamate;methyl 1-(methylamino)cyclopropane-1-carboxylate (PubChem CID 178168035) has the molecular formula C15H26N2O5 and a molecular weight of 314.38 g/mol. Its IUPAC name is tert-butyl N-(1-formylcyclopropyl)carbamate;methyl 1-(methylamino)cyclopropane-1-carboxylate.
| Compound Name | tert-butyl N-(1-formylcyclopropyl)carbamate;methyl 1-(methylamino)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 178168035 |
| Molecular Formula | C15H26N2O5 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | tert-butyl N-(1-formylcyclopropyl)carbamate;methyl 1-(methylamino)cyclopropane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)NC1(C=O)CC1.CNC1(C(=O)OC)CC1 |
| InChI | InChI=1S/C9H15NO3.C6H11NO2/c1-8(2,3)13-7(12)10-9(6-11)4-5-9;1-7-6(3-4-6)5(8)9-2/h6H,4-5H2,1-3H3,(H,10,12);7H,3-4H2,1-2H3 |
| InChIKey | RPQIEHDTVRULIU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|