C12H21N3O2 — CID 178168123
1-[(1S)-1-aminoethyl]-3-ethyl-3-methyl-4-prop-2-enoylpiperazin-2-one (PubChem CID 178168123) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 1-[(1S)-1-aminoethyl]-3-ethyl-3-methyl-4-prop-2-enoylpiperazin-2-one.
| Compound Name | 1-[(1S)-1-aminoethyl]-3-ethyl-3-methyl-4-prop-2-enoylpiperazin-2-one |
|---|---|
| PubChem CID | 178168123 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 1-[(1S)-1-aminoethyl]-3-ethyl-3-methyl-4-prop-2-enoylpiperazin-2-one |
| SMILES | C=CC(=O)N1CCN([C@@H](C)N)C(=O)C1(C)CC |
| InChI | InChI=1S/C12H21N3O2/c1-5-10(16)15-8-7-14(9(3)13)11(17)12(15,4)6-2/h5,9H,1,6-8,13H2,2-4H3/t9-,12?/m0/s1 |
| InChIKey | YTBZVLDWVNUGOM-QHGLUPRGSA-N |
| XLogP | 0.32 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|