C10H20N2 — CID 178168575
(2Z)-2-(methyliminomethyl)-N-propylpenta-2,4-dien-1-amine;molecular hydrogen (PubChem CID 178168575) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is (2Z)-2-(methyliminomethyl)-N-propylpenta-2,4-dien-1-amine;molecular hydrogen.
| Compound Name | (2Z)-2-(methyliminomethyl)-N-propylpenta-2,4-dien-1-amine;molecular hydrogen |
|---|---|
| PubChem CID | 178168575 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | (2Z)-2-(methyliminomethyl)-N-propylpenta-2,4-dien-1-amine;molecular hydrogen |
| SMILES | C=C/C=C(\C=N\C)CNCCC.[H][H] |
| InChI | InChI=1S/C10H18N2.H2/c1-4-6-10(8-11-3)9-12-7-5-2;/h4,6,8,12H,1,5,7,9H2,2-3H3;1H/b10-6+,11-8+; |
| InChIKey | CMVSITIRXJFGNK-ULNXZZPKSA-N |
| XLogP | 2.05 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|