C21H37NO3 — CID 143416915
7-[[(Z,2E)-6-hydroxy-2-prop-2-enylideneundec-3-enyl]amino]heptanoic acid (PubChem CID 143416915) has the molecular formula C21H37NO3 and a molecular weight of 351.53 g/mol. Its IUPAC name is 7-[[(Z,2E)-6-hydroxy-2-prop-2-enylideneundec-3-enyl]amino]heptanoic acid.
| Compound Name | 7-[[(Z,2E)-6-hydroxy-2-prop-2-enylideneundec-3-enyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 143416915 |
| Molecular Formula | C21H37NO3 |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.28 |
| IUPAC Name | 7-[[(Z,2E)-6-hydroxy-2-prop-2-enylideneundec-3-enyl]amino]heptanoic acid |
| SMILES | C=C/C=C(\C=C/CC(O)CCCCC)CNCCCCCCC(=O)O |
| InChI | InChI=1S/C21H37NO3/c1-3-5-8-14-20(23)15-11-13-19(12-4-2)18-22-17-10-7-6-9-16-21(24)25/h4,11-13,20,22-23H,2-3,5-10,14-18H2,1H3,(H,24,25)/b13-11-,19-12+ |
| InChIKey | GFAQFNPOZWCNQA-MDWFKHSNSA-N |
| XLogP | 4.61 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|