C16H25ClN2O2 — CID 178170644
(3R,4R)-1-acetyl-N-[(4E,6E)-7-chloroocta-4,6-dienyl]-4-methylpyrrolidine-3-carboxamide (PubChem CID 178170644) has the molecular formula C16H25ClN2O2 and a molecular weight of 312.84 g/mol. Its IUPAC name is (3R,4R)-1-acetyl-N-[(4E,6E)-7-chloroocta-4,6-dienyl]-4-methylpyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-1-acetyl-N-[(4E,6E)-7-chloroocta-4,6-dienyl]-4-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 178170644 |
| Molecular Formula | C16H25ClN2O2 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (3R,4R)-1-acetyl-N-[(4E,6E)-7-chloroocta-4,6-dienyl]-4-methylpyrrolidine-3-carboxamide |
| SMILES | CC(=O)N1C[C@H](C(=O)NCCC/C=C/C=C(\C)Cl)[C@@H](C)C1 |
| InChI | InChI=1S/C16H25ClN2O2/c1-12-10-19(14(3)20)11-15(12)16(21)18-9-7-5-4-6-8-13(2)17/h4,6,8,12,15H,5,7,9-11H2,1-3H3,(H,18,21)/b6-4+,13-8+/t12-,15-/m0/s1 |
| InChIKey | IKPFEJKPXIPOIM-UIGLEYLOSA-N |
| XLogP | 2.70 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|