C22H26O4 — CID 178182892
2-[(8R,9S,13S,14S,17S)-1-ethynyl-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]acetic acid (PubChem CID 178182892) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-[(8R,9S,13S,14S,17S)-1-ethynyl-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]acetic acid.
| Compound Name | 2-[(8R,9S,13S,14S,17S)-1-ethynyl-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]acetic acid |
|---|---|
| PubChem CID | 178182892 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 2-[(8R,9S,13S,14S,17S)-1-ethynyl-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]acetic acid |
| SMILES | C#Cc1c(CC(=O)O)c(O)cc2c1[C@H]1CC[C@]3(C)[C@@H](O)CC[C@H]3[C@@H]1CC2 |
| InChI | InChI=1S/C22H26O4/c1-3-13-16(11-20(25)26)18(23)10-12-4-5-14-15(21(12)13)8-9-22(2)17(14)6-7-19(22)24/h1,10,14-15,17,19,23-24H,4-9,11H2,2H3,(H,25,26)/t14-,15+,17+,19+,22+/m1/s1 |
| InChIKey | OVSOTEXZEGTVOG-BRKOAEBASA-N |
| XLogP | 3.22 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|