C30H24F7N3O6 — CID 18007701
4-fluoro-3-(isoquinolin-4-ylmethoxy)-N-(1,2,3,4-tetrahydroquinolin-6-yl)benzamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 18007701) has the molecular formula C30H24F7N3O6 and a molecular weight of 655.52 g/mol. Its IUPAC name is 4-fluoro-3-(isoquinolin-4-ylmethoxy)-N-(1,2,3,4-tetrahydroquinolin-6-yl)benzamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-fluoro-3-(isoquinolin-4-ylmethoxy)-N-(1,2,3,4-tetrahydroquinolin-6-yl)benzamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 18007701 |
| Molecular Formula | C30H24F7N3O6 |
| Molecular Weight | 655.52 g/mol |
| Exact Mass | 655.16 |
| IUPAC Name | 4-fluoro-3-(isoquinolin-4-ylmethoxy)-N-(1,2,3,4-tetrahydroquinolin-6-yl)benzamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(Nc1ccc2c(c1)CCCN2)c1ccc(F)c(OCc2cncc3ccccc23)c1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H22FN3O2.2C2HF3O2/c27-23-9-7-18(26(31)30-21-8-10-24-17(12-21)5-3-11-29-24)13-25(23)32-16-20-15-28-14-19-4-1-2-6-22(19)20;2*3-2(4,5)1(6)7/h1-2,4,6-10,12-15,29H,3,5,11,16H2,(H,30,31);2*(H,6,7) |
| InChIKey | BAUPVTVHVNSYJO-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 137.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.52 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |