C19H25NO4S — CID 18091698
[1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 3-hydroxyadamantane-1-carboxylate (PubChem CID 18091698) has the molecular formula C19H25NO4S and a molecular weight of 363.48 g/mol. Its IUPAC name is [1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 3-hydroxyadamantane-1-carboxylate.
| Compound Name | [1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 3-hydroxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 18091698 |
| Molecular Formula | C19H25NO4S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | [1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 3-hydroxyadamantane-1-carboxylate |
| SMILES | CC(OC(=O)C12CC3CC(CC(O)(C3)C1)C2)C(=O)NCc1cccs1 |
| InChI | InChI=1S/C19H25NO4S/c1-12(16(21)20-10-15-3-2-4-25-15)24-17(22)18-6-13-5-14(7-18)9-19(23,8-13)11-18/h2-4,12-14,23H,5-11H2,1H3,(H,20,21) |
| InChIKey | ZOWOQVGUPXCHKV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |