C20H29N5S — CID 18093142
5-cyclopropyl-2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]-4-ethyl-1,2,4-triazole-3-thione (PubChem CID 18093142) has the molecular formula C20H29N5S and a molecular weight of 371.55 g/mol. Its IUPAC name is 5-cyclopropyl-2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]-4-ethyl-1,2,4-triazole-3-thione.
| Compound Name | 5-cyclopropyl-2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]-4-ethyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 18093142 |
| Molecular Formula | C20H29N5S |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 5-cyclopropyl-2-[[4-(2,3-dimethylphenyl)piperazin-1-yl]methyl]-4-ethyl-1,2,4-triazole-3-thione |
| SMILES | CCn1c(C2CC2)nn(CN2CCN(c3cccc(C)c3C)CC2)c1=S |
| InChI | InChI=1S/C20H29N5S/c1-4-24-19(17-8-9-17)21-25(20(24)26)14-22-10-12-23(13-11-22)18-7-5-6-15(2)16(18)3/h5-7,17H,4,8-14H2,1-3H3 |
| InChIKey | GAIMQPUURLYLPK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|