C18H17N3O3 — CID 18096502
N-(furan-2-ylmethylcarbamoyl)-2-(naphthalen-1-ylamino)acetamide (PubChem CID 18096502) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is N-(furan-2-ylmethylcarbamoyl)-2-(naphthalen-1-ylamino)acetamide.
| Compound Name | N-(furan-2-ylmethylcarbamoyl)-2-(naphthalen-1-ylamino)acetamide |
|---|---|
| PubChem CID | 18096502 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | N-(furan-2-ylmethylcarbamoyl)-2-(naphthalen-1-ylamino)acetamide |
| SMILES | O=C(CNc1cccc2ccccc12)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C18H17N3O3/c22-17(21-18(23)20-11-14-7-4-10-24-14)12-19-16-9-3-6-13-5-1-2-8-15(13)16/h1-10,19H,11-12H2,(H2,20,21,22,23) |
| InChIKey | VEWAPOWFRNVHSE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |