C17H16N3O3+ — CID 8828950
N-(furan-2-ylmethylcarbamoyl)-2-isoquinolin-2-ium-2-ylacetamide (PubChem CID 8828950) has the molecular formula C17H16N3O3+ and a molecular weight of 310.33 g/mol. Its IUPAC name is N-(furan-2-ylmethylcarbamoyl)-2-isoquinolin-2-ium-2-ylacetamide.
| Compound Name | N-(furan-2-ylmethylcarbamoyl)-2-isoquinolin-2-ium-2-ylacetamide |
|---|---|
| PubChem CID | 8828950 |
| Molecular Formula | C17H16N3O3+ |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | N-(furan-2-ylmethylcarbamoyl)-2-isoquinolin-2-ium-2-ylacetamide |
| SMILES | O=C(C[n+]1ccc2ccccc2c1)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C17H15N3O3/c21-16(19-17(22)18-10-15-6-3-9-23-15)12-20-8-7-13-4-1-2-5-14(13)11-20/h1-9,11H,10,12H2,(H-,18,19,21,22)/p+1 |
| InChIKey | CZFZGDFGKXMYDC-UHFFFAOYSA-O |
| XLogP | 1.75 |
| TPSA | 75.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|