C16H19ClN4O2S — CID 18146989
3-[5-[2-(3-chlorophenoxy)ethylsulfanyl]-4-cyclopropyl-1,2,4-triazol-3-yl]propanamide (PubChem CID 18146989) has the molecular formula C16H19ClN4O2S and a molecular weight of 366.87 g/mol. Its IUPAC name is 3-[5-[2-(3-chlorophenoxy)ethylsulfanyl]-4-cyclopropyl-1,2,4-triazol-3-yl]propanamide.
| Compound Name | 3-[5-[2-(3-chlorophenoxy)ethylsulfanyl]-4-cyclopropyl-1,2,4-triazol-3-yl]propanamide |
|---|---|
| PubChem CID | 18146989 |
| Molecular Formula | C16H19ClN4O2S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 3-[5-[2-(3-chlorophenoxy)ethylsulfanyl]-4-cyclopropyl-1,2,4-triazol-3-yl]propanamide |
| SMILES | NC(=O)CCc1nnc(SCCOc2cccc(Cl)c2)n1C1CC1 |
| InChI | InChI=1S/C16H19ClN4O2S/c17-11-2-1-3-13(10-11)23-8-9-24-16-20-19-15(7-6-14(18)22)21(16)12-4-5-12/h1-3,10,12H,4-9H2,(H2,18,22) |
| InChIKey | LOGYLNBXSWWCRQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|