C30H31NO2 — CID 18182754
4-methyl-7-prop-1-en-2-yl-9-[4-(2-pyrrolidin-1-ylethoxy)phenyl]phenanthren-2-ol (PubChem CID 18182754) has the molecular formula C30H31NO2 and a molecular weight of 437.58 g/mol. Its IUPAC name is 4-methyl-7-prop-1-en-2-yl-9-[4-(2-pyrrolidin-1-ylethoxy)phenyl]phenanthren-2-ol.
| Compound Name | 4-methyl-7-prop-1-en-2-yl-9-[4-(2-pyrrolidin-1-ylethoxy)phenyl]phenanthren-2-ol |
|---|---|
| PubChem CID | 18182754 |
| Molecular Formula | C30H31NO2 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 4-methyl-7-prop-1-en-2-yl-9-[4-(2-pyrrolidin-1-ylethoxy)phenyl]phenanthren-2-ol |
| SMILES | C=C(C)c1ccc2c(c1)c(-c1ccc(OCCN3CCCC3)cc1)cc1cc(O)cc(C)c12 |
| InChI | InChI=1S/C30H31NO2/c1-20(2)23-8-11-27-29(18-23)28(19-24-17-25(32)16-21(3)30(24)27)22-6-9-26(10-7-22)33-15-14-31-12-4-5-13-31/h6-11,16-19,32H,1,4-5,12-15H2,2-3H3 |
| InChIKey | UGXHPACAEZIYIO-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|