C19H13FN2O2S2 — CID 18183358
4-[4-(4-cyanophenyl)-3-sulfanylidenecyclohexa-1,5-dien-1-yl]-2-fluorobenzenesulfonamide (PubChem CID 18183358) has the molecular formula C19H13FN2O2S2 and a molecular weight of 384.46 g/mol. Its IUPAC name is 4-[4-(4-cyanophenyl)-3-sulfanylidenecyclohexa-1,5-dien-1-yl]-2-fluorobenzenesulfonamide.
| Compound Name | 4-[4-(4-cyanophenyl)-3-sulfanylidenecyclohexa-1,5-dien-1-yl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 18183358 |
| Molecular Formula | C19H13FN2O2S2 |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 4-[4-(4-cyanophenyl)-3-sulfanylidenecyclohexa-1,5-dien-1-yl]-2-fluorobenzenesulfonamide |
| SMILES | N#Cc1ccc(C2C=CC(c3ccc(S(N)(=O)=O)c(F)c3)=CC2=S)cc1 |
| InChI | InChI=1S/C19H13FN2O2S2/c20-17-9-14(6-8-19(17)26(22,23)24)15-5-7-16(18(25)10-15)13-3-1-12(11-21)2-4-13/h1-10,16H,(H2,22,23,24) |
| InChIKey | NFWDQLSQKZBDKE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 83.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|