C16H12F2N2O2S3 — CID 22746398
2,6-difluoro-4-[4-(4-methyl-1,3-thiazol-2-yl)-3-sulfanylidenecyclohexa-1,5-dien-1-yl]benzenesulfonamide (PubChem CID 22746398) has the molecular formula C16H12F2N2O2S3 and a molecular weight of 398.48 g/mol. Its IUPAC name is 2,6-difluoro-4-[4-(4-methyl-1,3-thiazol-2-yl)-3-sulfanylidenecyclohexa-1,5-dien-1-yl]benzenesulfonamide.
| Compound Name | 2,6-difluoro-4-[4-(4-methyl-1,3-thiazol-2-yl)-3-sulfanylidenecyclohexa-1,5-dien-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 22746398 |
| Molecular Formula | C16H12F2N2O2S3 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | 2,6-difluoro-4-[4-(4-methyl-1,3-thiazol-2-yl)-3-sulfanylidenecyclohexa-1,5-dien-1-yl]benzenesulfonamide |
| SMILES | Cc1csc(C2C=CC(c3cc(F)c(S(N)(=O)=O)c(F)c3)=CC2=S)n1 |
| InChI | InChI=1S/C16H12F2N2O2S3/c1-8-7-24-16(20-8)11-3-2-9(6-14(11)23)10-4-12(17)15(13(18)5-10)25(19,21)22/h2-7,11H,1H3,(H2,19,21,22) |
| InChIKey | PSEQPWUTBJTICO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|