C18H12F3NO2S2 — CID 22747263
2,6-difluoro-4-[4-(4-fluorophenyl)-3-sulfanylidenecyclohexa-1,5-dien-1-yl]benzenesulfonamide (PubChem CID 22747263) has the molecular formula C18H12F3NO2S2 and a molecular weight of 395.43 g/mol. Its IUPAC name is 2,6-difluoro-4-[4-(4-fluorophenyl)-3-sulfanylidenecyclohexa-1,5-dien-1-yl]benzenesulfonamide.
| Compound Name | 2,6-difluoro-4-[4-(4-fluorophenyl)-3-sulfanylidenecyclohexa-1,5-dien-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 22747263 |
| Molecular Formula | C18H12F3NO2S2 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 2,6-difluoro-4-[4-(4-fluorophenyl)-3-sulfanylidenecyclohexa-1,5-dien-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(F)cc(C2=CC(=S)C(c3ccc(F)cc3)C=C2)cc1F |
| InChI | InChI=1S/C18H12F3NO2S2/c19-13-4-1-10(2-5-13)14-6-3-11(9-17(14)25)12-7-15(20)18(16(21)8-12)26(22,23)24/h1-9,14H,(H2,22,23,24) |
| InChIKey | JXGWMNOQCWSLCH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|