C19H14ClF2NO2S2 — CID 22746688
4-[4-(4-chloro-3-methylphenyl)-3-sulfanylidenecyclohexa-1,5-dien-1-yl]-2,6-difluorobenzenesulfonamide (PubChem CID 22746688) has the molecular formula C19H14ClF2NO2S2 and a molecular weight of 425.91 g/mol. Its IUPAC name is 4-[4-(4-chloro-3-methylphenyl)-3-sulfanylidenecyclohexa-1,5-dien-1-yl]-2,6-difluorobenzenesulfonamide.
| Compound Name | 4-[4-(4-chloro-3-methylphenyl)-3-sulfanylidenecyclohexa-1,5-dien-1-yl]-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 22746688 |
| Molecular Formula | C19H14ClF2NO2S2 |
| Molecular Weight | 425.91 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | 4-[4-(4-chloro-3-methylphenyl)-3-sulfanylidenecyclohexa-1,5-dien-1-yl]-2,6-difluorobenzenesulfonamide |
| SMILES | Cc1cc(C2C=CC(c3cc(F)c(S(N)(=O)=O)c(F)c3)=CC2=S)ccc1Cl |
| InChI | InChI=1S/C19H14ClF2NO2S2/c1-10-6-12(3-5-15(10)20)14-4-2-11(9-18(14)26)13-7-16(21)19(17(22)8-13)27(23,24)25/h2-9,14H,1H3,(H2,23,24,25) |
| InChIKey | SIXNGZCQBHBICE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.91 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|