C18H18N2O7S2 — CID 18198931
dimethyl 3-(2-methoxy-2-oxoethyl)-5-[(2-pyridin-2-ylsulfanylacetyl)amino]thiophene-2,4-dicarboxylate (PubChem CID 18198931) has the molecular formula C18H18N2O7S2 and a molecular weight of 438.48 g/mol. Its IUPAC name is dimethyl 3-(2-methoxy-2-oxoethyl)-5-[(2-pyridin-2-ylsulfanylacetyl)amino]thiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 3-(2-methoxy-2-oxoethyl)-5-[(2-pyridin-2-ylsulfanylacetyl)amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 18198931 |
| Molecular Formula | C18H18N2O7S2 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | dimethyl 3-(2-methoxy-2-oxoethyl)-5-[(2-pyridin-2-ylsulfanylacetyl)amino]thiophene-2,4-dicarboxylate |
| SMILES | COC(=O)Cc1c(C(=O)OC)sc(NC(=O)CSc2ccccn2)c1C(=O)OC |
| InChI | InChI=1S/C18H18N2O7S2/c1-25-13(22)8-10-14(17(23)26-2)16(29-15(10)18(24)27-3)20-11(21)9-28-12-6-4-5-7-19-12/h4-7H,8-9H2,1-3H3,(H,20,21) |
| InChIKey | JWMUQWJIEQBBQX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|