C21H27NO5 — CID 18201864
[2-(3-ethylpent-1-yn-3-ylamino)-2-oxoethyl] 4-(oxolan-2-ylmethoxy)benzoate (PubChem CID 18201864) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is [2-(3-ethylpent-1-yn-3-ylamino)-2-oxoethyl] 4-(oxolan-2-ylmethoxy)benzoate.
| Compound Name | [2-(3-ethylpent-1-yn-3-ylamino)-2-oxoethyl] 4-(oxolan-2-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 18201864 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | [2-(3-ethylpent-1-yn-3-ylamino)-2-oxoethyl] 4-(oxolan-2-ylmethoxy)benzoate |
| SMILES | C#CC(CC)(CC)NC(=O)COC(=O)c1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C21H27NO5/c1-4-21(5-2,6-3)22-19(23)15-27-20(24)16-9-11-17(12-10-16)26-14-18-8-7-13-25-18/h1,9-12,18H,5-8,13-15H2,2-3H3,(H,22,23) |
| InChIKey | OXDFHXJNMQQNAL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|