C14H27N7O6 — CID 18223811
5-amino-2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid (PubChem CID 18223811) has the molecular formula C14H27N7O6 and a molecular weight of 389.41 g/mol. Its IUPAC name is 5-amino-2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18223811 |
| Molecular Formula | C14H27N7O6 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 5-amino-2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CO)C(=O)O |
| InChI | InChI=1S/C14H27N7O6/c15-7(6-22)11(24)20-8(2-1-5-19-14(17)18)12(25)21-9(13(26)27)3-4-10(16)23/h7-9,22H,1-6,15H2,(H2,16,23)(H,20,24)(H,21,25)(H,26,27)(H4,17,18,19) |
| InChIKey | QWZIOCFPXMAXET-UHFFFAOYSA-N |
| XLogP | -4.32 |
| TPSA | 249.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | -4.32 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|