C21H24FN3O4S — CID 18225646
(1-butyl-5-sulfamoylbenzimidazol-2-yl)methyl 3-(4-fluorophenyl)propanoate (PubChem CID 18225646) has the molecular formula C21H24FN3O4S and a molecular weight of 433.51 g/mol. Its IUPAC name is (1-butyl-5-sulfamoylbenzimidazol-2-yl)methyl 3-(4-fluorophenyl)propanoate.
| Compound Name | (1-butyl-5-sulfamoylbenzimidazol-2-yl)methyl 3-(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 18225646 |
| Molecular Formula | C21H24FN3O4S |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | (1-butyl-5-sulfamoylbenzimidazol-2-yl)methyl 3-(4-fluorophenyl)propanoate |
| SMILES | CCCCn1c(COC(=O)CCc2ccc(F)cc2)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C21H24FN3O4S/c1-2-3-12-25-19-10-9-17(30(23,27)28)13-18(19)24-20(25)14-29-21(26)11-6-15-4-7-16(22)8-5-15/h4-5,7-10,13H,2-3,6,11-12,14H2,1H3,(H2,23,27,28) |
| InChIKey | AFOXQIJAWRLBCY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |