C19H19ClN4O6S — CID 29349929
(1-butyl-5-sulfamoylbenzimidazol-2-yl)methyl 2-chloro-4-nitrobenzoate (PubChem CID 29349929) has the molecular formula C19H19ClN4O6S and a molecular weight of 466.90 g/mol. Its IUPAC name is (1-butyl-5-sulfamoylbenzimidazol-2-yl)methyl 2-chloro-4-nitrobenzoate.
| Compound Name | (1-butyl-5-sulfamoylbenzimidazol-2-yl)methyl 2-chloro-4-nitrobenzoate |
|---|---|
| PubChem CID | 29349929 |
| Molecular Formula | C19H19ClN4O6S |
| Molecular Weight | 466.90 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | (1-butyl-5-sulfamoylbenzimidazol-2-yl)methyl 2-chloro-4-nitrobenzoate |
| SMILES | CCCCn1c(COC(=O)c2ccc([N+](=O)[O-])cc2Cl)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C19H19ClN4O6S/c1-2-3-8-23-17-7-5-13(31(21,28)29)10-16(17)22-18(23)11-30-19(25)14-6-4-12(24(26)27)9-15(14)20/h4-7,9-10H,2-3,8,11H2,1H3,(H2,21,28,29) |
| InChIKey | HIJZFBPFOMAOIY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 147.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.90 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|