C20H23N3O5S — CID 40709893
(1-butyl-5-sulfamoylbenzimidazol-2-yl)methyl 2-hydroxy-3-methylbenzoate (PubChem CID 40709893) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is (1-butyl-5-sulfamoylbenzimidazol-2-yl)methyl 2-hydroxy-3-methylbenzoate.
| Compound Name | (1-butyl-5-sulfamoylbenzimidazol-2-yl)methyl 2-hydroxy-3-methylbenzoate |
|---|---|
| PubChem CID | 40709893 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | (1-butyl-5-sulfamoylbenzimidazol-2-yl)methyl 2-hydroxy-3-methylbenzoate |
| SMILES | CCCCn1c(COC(=O)c2cccc(C)c2O)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C20H23N3O5S/c1-3-4-10-23-17-9-8-14(29(21,26)27)11-16(17)22-18(23)12-28-20(25)15-7-5-6-13(2)19(15)24/h5-9,11,24H,3-4,10,12H2,1-2H3,(H2,21,26,27) |
| InChIKey | GBTHDGVXGJMMSY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |