C22H29N5O3S — CID 39777111
1-butyl-2-[[4-(4-hydroxyphenyl)piperazin-1-yl]methyl]benzimidazole-5-sulfonamide (PubChem CID 39777111) has the molecular formula C22H29N5O3S and a molecular weight of 443.57 g/mol. Its IUPAC name is 1-butyl-2-[[4-(4-hydroxyphenyl)piperazin-1-yl]methyl]benzimidazole-5-sulfonamide.
| Compound Name | 1-butyl-2-[[4-(4-hydroxyphenyl)piperazin-1-yl]methyl]benzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 39777111 |
| Molecular Formula | C22H29N5O3S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 1-butyl-2-[[4-(4-hydroxyphenyl)piperazin-1-yl]methyl]benzimidazole-5-sulfonamide |
| SMILES | CCCCn1c(CN2CCN(c3ccc(O)cc3)CC2)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C22H29N5O3S/c1-2-3-10-27-21-9-8-19(31(23,29)30)15-20(21)24-22(27)16-25-11-13-26(14-12-25)17-4-6-18(28)7-5-17/h4-9,15,28H,2-3,10-14,16H2,1H3,(H2,23,29,30) |
| InChIKey | HMFMWIZDSQJRMH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |