C20H21N5O4S — CID 29351454
(1-butyl-5-sulfamoylbenzimidazol-2-yl)methyl 1H-indazole-3-carboxylate (PubChem CID 29351454) has the molecular formula C20H21N5O4S and a molecular weight of 427.49 g/mol. Its IUPAC name is (1-butyl-5-sulfamoylbenzimidazol-2-yl)methyl 1H-indazole-3-carboxylate.
| Compound Name | (1-butyl-5-sulfamoylbenzimidazol-2-yl)methyl 1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 29351454 |
| Molecular Formula | C20H21N5O4S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | (1-butyl-5-sulfamoylbenzimidazol-2-yl)methyl 1H-indazole-3-carboxylate |
| SMILES | CCCCn1c(COC(=O)c2n[nH]c3ccccc23)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C20H21N5O4S/c1-2-3-10-25-17-9-8-13(30(21,27)28)11-16(17)22-18(25)12-29-20(26)19-14-6-4-5-7-15(14)23-24-19/h4-9,11H,2-3,10,12H2,1H3,(H,23,24)(H2,21,27,28) |
| InChIKey | QSUHMCWNPBEZPH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |