C23H28N4O5S — CID 32512230
(1-butyl-5-sulfamoylbenzimidazol-2-yl)methyl 3-[(2-methylbenzoyl)amino]propanoate (PubChem CID 32512230) has the molecular formula C23H28N4O5S and a molecular weight of 472.57 g/mol. Its IUPAC name is (1-butyl-5-sulfamoylbenzimidazol-2-yl)methyl 3-[(2-methylbenzoyl)amino]propanoate.
| Compound Name | (1-butyl-5-sulfamoylbenzimidazol-2-yl)methyl 3-[(2-methylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 32512230 |
| Molecular Formula | C23H28N4O5S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | (1-butyl-5-sulfamoylbenzimidazol-2-yl)methyl 3-[(2-methylbenzoyl)amino]propanoate |
| SMILES | CCCCn1c(COC(=O)CCNC(=O)c2ccccc2C)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C23H28N4O5S/c1-3-4-13-27-20-10-9-17(33(24,30)31)14-19(20)26-21(27)15-32-22(28)11-12-25-23(29)18-8-6-5-7-16(18)2/h5-10,14H,3-4,11-13,15H2,1-2H3,(H,25,29)(H2,24,30,31) |
| InChIKey | FNONLTDXERWQSA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 133.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |