C22H17ClN2OS — CID 18274205
(E)-3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-2-(4-propylbenzoyl)prop-2-enenitrile (PubChem CID 18274205) has the molecular formula C22H17ClN2OS and a molecular weight of 392.91 g/mol. Its IUPAC name is (E)-3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-2-(4-propylbenzoyl)prop-2-enenitrile.
| Compound Name | (E)-3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-2-(4-propylbenzoyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 18274205 |
| Molecular Formula | C22H17ClN2OS |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | (E)-3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-2-(4-propylbenzoyl)prop-2-enenitrile |
| SMILES | CCCc1ccc(C(=O)/C(C#N)=C/c2csc(-c3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C22H17ClN2OS/c1-2-3-15-4-6-16(7-5-15)21(26)18(13-24)12-20-14-27-22(25-20)17-8-10-19(23)11-9-17/h4-12,14H,2-3H2,1H3/b18-12+ |
| InChIKey | ZCLUYDGZRCRFAH-LDADJPATSA-N |
| XLogP | 6.21 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|