C21H18N2O4S2 — CID 18276982
[4-(2-cyanophenyl)phenyl]methyl 3-(thiophen-2-ylsulfonylamino)propanoate (PubChem CID 18276982) has the molecular formula C21H18N2O4S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is [4-(2-cyanophenyl)phenyl]methyl 3-(thiophen-2-ylsulfonylamino)propanoate.
| Compound Name | [4-(2-cyanophenyl)phenyl]methyl 3-(thiophen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 18276982 |
| Molecular Formula | C21H18N2O4S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | [4-(2-cyanophenyl)phenyl]methyl 3-(thiophen-2-ylsulfonylamino)propanoate |
| SMILES | N#Cc1ccccc1-c1ccc(COC(=O)CCNS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C21H18N2O4S2/c22-14-18-4-1-2-5-19(18)17-9-7-16(8-10-17)15-27-20(24)11-12-23-29(25,26)21-6-3-13-28-21/h1-10,13,23H,11-12,15H2 |
| InChIKey | ITVTZORZYFSYHF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |