C28H24N4O3S — CID 18315553
N-(benzenesulfonyl)-2-(methylamino)-1-[(4-phenylphenyl)methyl]benzimidazole-4-carboxamide (PubChem CID 18315553) has the molecular formula C28H24N4O3S and a molecular weight of 496.59 g/mol. Its IUPAC name is N-(benzenesulfonyl)-2-(methylamino)-1-[(4-phenylphenyl)methyl]benzimidazole-4-carboxamide.
| Compound Name | N-(benzenesulfonyl)-2-(methylamino)-1-[(4-phenylphenyl)methyl]benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 18315553 |
| Molecular Formula | C28H24N4O3S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | N-(benzenesulfonyl)-2-(methylamino)-1-[(4-phenylphenyl)methyl]benzimidazole-4-carboxamide |
| SMILES | CNc1nc2c(C(=O)NS(=O)(=O)c3ccccc3)cccc2n1Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24N4O3S/c1-29-28-30-26-24(27(33)31-36(34,35)23-11-6-3-7-12-23)13-8-14-25(26)32(28)19-20-15-17-22(18-16-20)21-9-4-2-5-10-21/h2-18H,19H2,1H3,(H,29,30)(H,31,33) |
| InChIKey | JPNFJCKFZIQVTG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |