C28H30ClN3O2S2 — CID 18319709
2-(3-benzyl-2-sulfanylidene-1,3-thiazol-4-yl)-N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]acetamide;hydrochloride (PubChem CID 18319709) has the molecular formula C28H30ClN3O2S2 and a molecular weight of 540.15 g/mol. Its IUPAC name is 2-(3-benzyl-2-sulfanylidene-1,3-thiazol-4-yl)-N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]acetamide;hydrochloride.
| Compound Name | 2-(3-benzyl-2-sulfanylidene-1,3-thiazol-4-yl)-N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 18319709 |
| Molecular Formula | C28H30ClN3O2S2 |
| Molecular Weight | 540.15 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | 2-(3-benzyl-2-sulfanylidene-1,3-thiazol-4-yl)-N-[4-[2-[(2-hydroxy-2-phenylethyl)amino]ethyl]phenyl]acetamide;hydrochloride |
| SMILES | Cl.O=C(Cc1csc(=S)n1Cc1ccccc1)Nc1ccc(CCNCC(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H29N3O2S2.ClH/c32-26(23-9-5-2-6-10-23)18-29-16-15-21-11-13-24(14-12-21)30-27(33)17-25-20-35-28(34)31(25)19-22-7-3-1-4-8-22;/h1-14,20,26,29,32H,15-19H2,(H,30,33);1H |
| InChIKey | IZACAEWKOXZRCB-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.15 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|